C21H18F3NOS — CID 46572832
N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-2-(trifluoromethyl)benzamide (PubChem CID 46572832) has the molecular formula C21H18F3NOS and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46572832 |
| Molecular Formula | C21H18F3NOS |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCc1ccc(C(NC(=O)c2ccccc2C(F)(F)F)c2cccs2)cc1 |
| InChI | InChI=1S/C21H18F3NOS/c1-2-14-9-11-15(12-10-14)19(18-8-5-13-27-18)25-20(26)16-6-3-4-7-17(16)21(22,23)24/h3-13,19H,2H2,1H3,(H,25,26) |
| InChIKey | FDFBEDZWQXJEBS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |