C19H28N3S2+ — CID 9096422
3-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]carbamothioylamino]propyl-dimethylazanium (PubChem CID 9096422) has the molecular formula C19H28N3S2+ and a molecular weight of 362.59 g/mol. Its IUPAC name is 3-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]carbamothioylamino]propyl-dimethylazanium.
| Compound Name | 3-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]carbamothioylamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 9096422 |
| Molecular Formula | C19H28N3S2+ |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]carbamothioylamino]propyl-dimethylazanium |
| SMILES | CCc1ccc([C@H](NC(=S)NCCC[NH+](C)C)c2cccs2)cc1 |
| InChI | InChI=1S/C19H27N3S2/c1-4-15-8-10-16(11-9-15)18(17-7-5-14-24-17)21-19(23)20-12-6-13-22(2)3/h5,7-11,14,18H,4,6,12-13H2,1-3H3,(H2,20,21,23)/p+1/t18-/m0/s1 |
| InChIKey | DEJLAOPXUDAUOM-SFHVURJKSA-O |
| XLogP | 2.40 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|