C13H22N2OS2 — CID 115573195
1-(3-methoxypropyl)-3-(2-methyl-1-thiophen-2-ylpropyl)thiourea (PubChem CID 115573195) has the molecular formula C13H22N2OS2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(2-methyl-1-thiophen-2-ylpropyl)thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-(2-methyl-1-thiophen-2-ylpropyl)thiourea |
|---|---|
| PubChem CID | 115573195 |
| Molecular Formula | C13H22N2OS2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(2-methyl-1-thiophen-2-ylpropyl)thiourea |
| SMILES | COCCCNC(=S)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C13H22N2OS2/c1-10(2)12(11-6-4-9-18-11)15-13(17)14-7-5-8-16-3/h4,6,9-10,12H,5,7-8H2,1-3H3,(H2,14,15,17) |
| InChIKey | JDEOCZAAUIXLRN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|