C19H27N3S2 — CID 9096426
1-[3-(dimethylamino)propyl]-3-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]thiourea (PubChem CID 9096426) has the molecular formula C19H27N3S2 and a molecular weight of 361.58 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]thiourea |
|---|---|
| PubChem CID | 9096426 |
| Molecular Formula | C19H27N3S2 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]thiourea |
| SMILES | CCc1ccc([C@@H](NC(=S)NCCCN(C)C)c2cccs2)cc1 |
| InChI | InChI=1S/C19H27N3S2/c1-4-15-8-10-16(11-9-15)18(17-7-5-14-24-17)21-19(23)20-12-6-13-22(2)3/h5,7-11,14,18H,4,6,12-13H2,1-3H3,(H2,20,21,23)/t18-/m1/s1 |
| InChIKey | DEJLAOPXUDAUOM-GOSISDBHSA-N |
| XLogP | 3.82 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|