C13H16N2OS2 — CID 129355017
1-propyl-3-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]urea (PubChem CID 129355017) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-propyl-3-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]urea.
| Compound Name | 1-propyl-3-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]urea |
|---|---|
| PubChem CID | 129355017 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-propyl-3-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]urea |
| SMILES | CCCNC(=O)N[C@@H](c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C13H16N2OS2/c1-2-6-14-13(16)15-12(10-5-8-17-9-10)11-4-3-7-18-11/h3-5,7-9,12H,2,6H2,1H3,(H2,14,15,16)/t12-/m0/s1 |
| InChIKey | REPZJKCVEKGFCC-LBPRGKRZSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |