C17H15NO2S2 — CID 121021382
4-methoxy-N-[thiophen-2-yl(thiophen-3-yl)methyl]benzamide (PubChem CID 121021382) has the molecular formula C17H15NO2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 4-methoxy-N-[thiophen-2-yl(thiophen-3-yl)methyl]benzamide.
| Compound Name | 4-methoxy-N-[thiophen-2-yl(thiophen-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 121021382 |
| Molecular Formula | C17H15NO2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-methoxy-N-[thiophen-2-yl(thiophen-3-yl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(c2ccsc2)c2cccs2)cc1 |
| InChI | InChI=1S/C17H15NO2S2/c1-20-14-6-4-12(5-7-14)17(19)18-16(13-8-10-21-11-13)15-3-2-9-22-15/h2-11,16H,1H3,(H,18,19) |
| InChIKey | UGNLGWWTWGXAQP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |