C14H15NOS2 — CID 119104241
2-cyclopropyl-N-[thiophen-2-yl(thiophen-3-yl)methyl]acetamide (PubChem CID 119104241) has the molecular formula C14H15NOS2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-cyclopropyl-N-[thiophen-2-yl(thiophen-3-yl)methyl]acetamide.
| Compound Name | 2-cyclopropyl-N-[thiophen-2-yl(thiophen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 119104241 |
| Molecular Formula | C14H15NOS2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-cyclopropyl-N-[thiophen-2-yl(thiophen-3-yl)methyl]acetamide |
| SMILES | O=C(CC1CC1)NC(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C14H15NOS2/c16-13(8-10-3-4-10)15-14(11-5-7-17-9-11)12-2-1-6-18-12/h1-2,5-7,9-10,14H,3-4,8H2,(H,15,16) |
| InChIKey | SMEPYJBVWNDBDX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |