C18H16ClNOS2 — CID 129354627
3-(3-chlorophenyl)-N-[(R)-thiophen-2-yl(thiophen-3-yl)methyl]propanamide (PubChem CID 129354627) has the molecular formula C18H16ClNOS2 and a molecular weight of 361.92 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[(R)-thiophen-2-yl(thiophen-3-yl)methyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[(R)-thiophen-2-yl(thiophen-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 129354627 |
| Molecular Formula | C18H16ClNOS2 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[(R)-thiophen-2-yl(thiophen-3-yl)methyl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)N[C@H](c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C18H16ClNOS2/c19-15-4-1-3-13(11-15)6-7-17(21)20-18(14-8-10-22-12-14)16-5-2-9-23-16/h1-5,8-12,18H,6-7H2,(H,20,21)/t18-/m1/s1 |
| InChIKey | FVGMWLAZGJALHQ-GOSISDBHSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |