C26H31N3OS — CID 25495715
N-(1-benzylpiperidin-4-yl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide (PubChem CID 25495715) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 25495715 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
| SMILES | Cc1ccc([C@H](NCC(=O)NC2CCN(Cc3ccccc3)CC2)c2cccs2)cc1 |
| InChI | InChI=1S/C26H31N3OS/c1-20-9-11-22(12-10-20)26(24-8-5-17-31-24)27-18-25(30)28-23-13-15-29(16-14-23)19-21-6-3-2-4-7-21/h2-12,17,23,26-27H,13-16,18-19H2,1H3,(H,28,30)/t26-/m0/s1 |
| InChIKey | GADGSAWEAJMXJS-SANMLTNESA-N |
| XLogP | 4.52 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |