C19H24N2O3S — CID 9136375
methyl N-[(2S)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]propanoyl]carbamate (PubChem CID 9136375) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is methyl N-[(2S)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]propanoyl]carbamate.
| Compound Name | methyl N-[(2S)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]propanoyl]carbamate |
|---|---|
| PubChem CID | 9136375 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | methyl N-[(2S)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]propanoyl]carbamate |
| SMILES | CCCc1ccc([C@@H](N[C@@H](C)C(=O)NC(=O)OC)c2cccs2)cc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-4-6-14-8-10-15(11-9-14)17(16-7-5-12-25-16)20-13(2)18(22)21-19(23)24-3/h5,7-13,17,20H,4,6H2,1-3H3,(H,21,22,23)/t13-,17+/m0/s1 |
| InChIKey | VYBWZUZZFCLZBP-SUMWQHHRSA-N |
| XLogP | 3.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |