C26H29O3S+ — CID 147878361
6-tetracyclo[5.2.1.03,5.03,9]decanyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate (PubChem CID 147878361) has the molecular formula C26H29O3S+ and a molecular weight of 421.58 g/mol. Its IUPAC name is 6-tetracyclo[5.2.1.03,5.03,9]decanyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate.
| Compound Name | 6-tetracyclo[5.2.1.03,5.03,9]decanyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
|---|---|
| PubChem CID | 147878361 |
| Molecular Formula | C26H29O3S+ |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 6-tetracyclo[5.2.1.03,5.03,9]decanyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
| SMILES | O=C(COc1ccc([S+]2CCCC2)c2ccccc12)OC1C2CC3CC4(CC14)C3C2 |
| InChI | InChI=1S/C26H29O3S/c27-24(29-25-16-11-17-13-26(14-21(25)26)20(17)12-16)15-28-22-7-8-23(30-9-3-4-10-30)19-6-2-1-5-18(19)22/h1-2,5-8,16-17,20-21,25H,3-4,9-15H2/q+1 |
| InChIKey | HZYLEWXEODZDEH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|