About quinolin-4-yl propanoate
quinolin-4-yl propanoate (PubChem CID 174834385) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is quinolin-4-yl propanoate.
Molecular Properties
| Compound Name | quinolin-4-yl propanoate |
| PubChem CID | 174834385 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | quinolin-4-yl propanoate |
| SMILES | CCC(=O)Oc1ccnc2ccccc12 |
| InChI | InChI=1S/C12H11NO2/c1-2-12(14)15-11-7-8-13-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3 |
| InChIKey | GEPBSQRNKGSDMM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinolin-4-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-4-yl propanoate?
The IUPAC name of quinolin-4-yl propanoate (CID 174834385) is quinolin-4-yl propanoate.
What is the SMILES notation for quinolin-4-yl propanoate?
The canonical SMILES for quinolin-4-yl propanoate is CCC(=O)Oc1ccnc2ccccc12.
What is the InChIKey of quinolin-4-yl propanoate?
The InChIKey is GEPBSQRNKGSDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c1-2-12(14)15-11-7-8-13-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3.
What are the key properties of quinolin-4-yl propanoate?
quinolin-4-yl propanoate has a molecular weight of 201.22 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-4-yl propanoate is sourced from PubChem (CID 174834385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).