C15H19ClN2O2 — CID 160803103
quinolin-4-yl 4-amino-3,3-dimethylbutanoate;hydrochloride (PubChem CID 160803103) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is quinolin-4-yl 4-amino-3,3-dimethylbutanoate;hydrochloride.
| Compound Name | quinolin-4-yl 4-amino-3,3-dimethylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 160803103 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | quinolin-4-yl 4-amino-3,3-dimethylbutanoate;hydrochloride |
| SMILES | CC(C)(CN)CC(=O)Oc1ccnc2ccccc12.Cl |
| InChI | InChI=1S/C15H18N2O2.ClH/c1-15(2,10-16)9-14(18)19-13-7-8-17-12-6-4-3-5-11(12)13;/h3-8H,9-10,16H2,1-2H3;1H |
| InChIKey | OLHUSDJTZPDVJJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |