C17H26N2O2S — CID 119939633
N-[4-(3-methylbutoxy)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119939633) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is N-[4-(3-methylbutoxy)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[4-(3-methylbutoxy)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119939633 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[4-(3-methylbutoxy)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CC(C)CCOc1ccc(NC(=O)CC2CSCCN2)cc1 |
| InChI | InChI=1S/C17H26N2O2S/c1-13(2)7-9-21-16-5-3-14(4-6-16)19-17(20)11-15-12-22-10-8-18-15/h3-6,13,15,18H,7-12H2,1-2H3,(H,19,20) |
| InChIKey | YNZWIMNMHADTCX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |