C49H57N5O6 — CID 140837400
N-[6-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(hydroxymethyl)piperidin-1-yl]-6-oxohexyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide (PubChem CID 140837400) has the molecular formula C49H57N5O6 and a molecular weight of 812.02 g/mol. Its IUPAC name is N-[6-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(hydroxymethyl)piperidin-1-yl]-6-oxohexyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide.
| Compound Name | N-[6-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(hydroxymethyl)piperidin-1-yl]-6-oxohexyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide |
|---|---|
| PubChem CID | 140837400 |
| Molecular Formula | C49H57N5O6 |
| Molecular Weight | 812.02 g/mol |
| Exact Mass | 811.43 |
| IUPAC Name | N-[6-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(hydroxymethyl)piperidin-1-yl]-6-oxohexyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide |
| SMILES | COc1ccc(C(OCC2(CO)CCN(C(=O)CCCCCNC(=O)c3ccc(/N=N/c4ccc(N(C)C)cc4)cc3)CC2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C49H57N5O6/c1-53(2)43-24-22-42(23-25-43)52-51-41-20-14-37(15-21-41)47(57)50-32-10-6-9-13-46(56)54-33-30-48(35-55,31-34-54)36-60-49(38-11-7-5-8-12-38,39-16-26-44(58-3)27-17-39)40-18-28-45(59-4)29-19-40/h5,7-8,11-12,14-29,55H,6,9-10,13,30-36H2,1-4H3,(H,50,57)/b52-51+ |
| InChIKey | LOMXKOBKFMVZLX-WYYOLBRMSA-N |
| XLogP | 9.09 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.02 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|