C27H29F2N3O — CID 10789674
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(E)-3-pyridin-3-ylprop-2-enyl]piperazine (PubChem CID 10789674) has the molecular formula C27H29F2N3O and a molecular weight of 449.55 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(E)-3-pyridin-3-ylprop-2-enyl]piperazine.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(E)-3-pyridin-3-ylprop-2-enyl]piperazine |
|---|---|
| PubChem CID | 10789674 |
| Molecular Formula | C27H29F2N3O |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(E)-3-pyridin-3-ylprop-2-enyl]piperazine |
| SMILES | Fc1ccc(C(OCCN2CCN(C/C=C/c3cccnc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H29F2N3O/c28-25-9-5-23(6-10-25)27(24-7-11-26(29)12-8-24)33-20-19-32-17-15-31(16-18-32)14-2-4-22-3-1-13-30-21-22/h1-13,21,27H,14-20H2/b4-2+ |
| InChIKey | FNQVTBNCYVCVGY-DUXPYHPUSA-N |
| XLogP | 4.80 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |