C30H43N3O13 — CID 3067390
tris(but-2-enedioic acid);3-[4-[3-(dimethylamino)-1-phenylpropyl]piperazin-1-yl]propan-1-ol (PubChem CID 3067390) has the molecular formula C30H43N3O13 and a molecular weight of 653.68 g/mol. Its IUPAC name is tris(but-2-enedioic acid);3-[4-[3-(dimethylamino)-1-phenylpropyl]piperazin-1-yl]propan-1-ol.
| Compound Name | tris(but-2-enedioic acid);3-[4-[3-(dimethylamino)-1-phenylpropyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 3067390 |
| Molecular Formula | C30H43N3O13 |
| Molecular Weight | 653.68 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | tris(but-2-enedioic acid);3-[4-[3-(dimethylamino)-1-phenylpropyl]piperazin-1-yl]propan-1-ol |
| SMILES | CN(C)CCC(c1ccccc1)N1CCN(CCCO)CC1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H31N3O.3C4H4O4/c1-19(2)11-9-18(17-7-4-3-5-8-17)21-14-12-20(13-15-21)10-6-16-22;3*5-3(6)1-2-4(7)8/h3-5,7-8,18,22H,6,9-16H2,1-2H3;3*1-2H,(H,5,6)(H,7,8) |
| InChIKey | UONNCAGRWOKDSN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 253.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.68 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|