C20H26N2O7 — CID 67623511
(E)-but-2-enedioic acid;3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one (PubChem CID 67623511) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one.
| Compound Name | (E)-but-2-enedioic acid;3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67623511 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1OCCN1C(CCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O3.C4H4O4/c19-16-18(10-13-21-16)15(14-4-2-1-3-5-14)6-7-17-8-11-20-12-9-17;5-3(6)1-2-4(7)8/h1-5,15H,6-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VGYJCLHEZDWMKI-WLHGVMLRSA-N |
| XLogP | 1.61 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|