C27H31FN2O7 — CID 67622924
(E)-but-2-enedioic acid;5-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one (PubChem CID 67622924) has the molecular formula C27H31FN2O7 and a molecular weight of 514.55 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one.
| Compound Name | (E)-but-2-enedioic acid;5-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67622924 |
| Molecular Formula | C27H31FN2O7 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-yl-1-phenylpropyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1OC(Cc2ccc(F)cc2)CN1C(CCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H27FN2O3.C4H4O4/c24-20-8-6-18(7-9-20)16-21-17-26(23(27)29-21)22(19-4-2-1-3-5-19)10-11-25-12-14-28-15-13-25;5-3(6)1-2-4(7)8/h1-9,21-22H,10-17H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UZGVDCQGQBMWPU-WLHGVMLRSA-N |
| XLogP | 3.36 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|