C25H32N2O5 — CID 20840186
(Z)-but-2-enedioic acid;1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine (PubChem CID 20840186) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine.
| Compound Name | (Z)-but-2-enedioic acid;1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 20840186 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine |
| SMILES | COc1ccc(C(CCc2ccccc2)N2CCN(C)CC2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H28N2O.C4H4O4/c1-22-14-16-23(17-15-22)21(13-8-18-6-4-3-5-7-18)19-9-11-20(24-2)12-10-19;5-3(6)1-2-4(7)8/h3-7,9-12,21H,8,13-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RLPDIGSRZPVBQD-BTJKTKAUSA-N |
| XLogP | 3.33 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|