C29H37N3O2 — CID 142932601
anisole;N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]benzamide (PubChem CID 142932601) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is anisole;N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]benzamide.
| Compound Name | anisole;N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 142932601 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | anisole;N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]benzamide |
| SMILES | CC(c1ccc(CCNC(=O)c2ccccc2)cc1)N1CCN(C)CC1.COc1ccccc1 |
| InChI | InChI=1S/C22H29N3O.C7H8O/c1-18(25-16-14-24(2)15-17-25)20-10-8-19(9-11-20)12-13-23-22(26)21-6-4-3-5-7-21;1-8-7-5-3-2-4-6-7/h3-11,18H,12-17H2,1-2H3,(H,23,26);2-6H,1H3 |
| InChIKey | XUYVGAPRNACNCX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |