C29H35N3O2 — CID 23090894
N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]-4-phenylmethoxybenzamide (PubChem CID 23090894) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 23090894 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-[2-[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]ethyl]-4-phenylmethoxybenzamide |
| SMILES | CC(c1ccc(CCNC(=O)c2ccc(OCc3ccccc3)cc2)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C29H35N3O2/c1-23(32-20-18-31(2)19-21-32)26-10-8-24(9-11-26)16-17-30-29(33)27-12-14-28(15-13-27)34-22-25-6-4-3-5-7-25/h3-15,23H,16-22H2,1-2H3,(H,30,33) |
| InChIKey | MOWUYKCFLBKPCX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |