C22H28F2N2O — CID 72949866
1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-(4-fluorophenyl)piperidin-4-ol (PubChem CID 72949866) has the molecular formula C22H28F2N2O and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-(4-fluorophenyl)piperidin-4-ol.
| Compound Name | 1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-(4-fluorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 72949866 |
| Molecular Formula | C22H28F2N2O |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-(4-fluorophenyl)piperidin-4-ol |
| SMILES | CN(C)CCC(c1ccc(F)cc1)N1CCC(O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H28F2N2O/c1-25(2)14-11-21(17-3-7-19(23)8-4-17)26-15-12-22(27,13-16-26)18-5-9-20(24)10-6-18/h3-10,21,27H,11-16H2,1-2H3 |
| InChIKey | TYDGFNCFZFHFEZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |