C29H42Cl2FNO3Si — CID 70235990
1-[1-[3,5-dichloro-4-tri(propan-2-yl)silyloxyphenyl]-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol (PubChem CID 70235990) has the molecular formula C29H42Cl2FNO3Si and a molecular weight of 570.65 g/mol. Its IUPAC name is 1-[1-[3,5-dichloro-4-tri(propan-2-yl)silyloxyphenyl]-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol.
| Compound Name | 1-[1-[3,5-dichloro-4-tri(propan-2-yl)silyloxyphenyl]-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 70235990 |
| Molecular Formula | C29H42Cl2FNO3Si |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | 1-[1-[3,5-dichloro-4-tri(propan-2-yl)silyloxyphenyl]-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol |
| SMILES | CC(C(O)c1cc(Cl)c(O[Si](C(C)C)(C(C)C)C(C)C)c(Cl)c1)N1CCC(O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H42Cl2FNO3Si/c1-18(2)37(19(3)4,20(5)6)36-28-25(30)16-22(17-26(28)31)27(34)21(7)33-14-12-29(35,13-15-33)23-8-10-24(32)11-9-23/h8-11,16-21,27,34-35H,12-15H2,1-7H3 |
| InChIKey | KLXUKLHNGRGHOO-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|