C16H26FN — CID 81022530
N-tert-butyl-3-(5-fluoro-2-methylphenyl)-3-methylbutan-1-amine (PubChem CID 81022530) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is N-tert-butyl-3-(5-fluoro-2-methylphenyl)-3-methylbutan-1-amine.
| Compound Name | N-tert-butyl-3-(5-fluoro-2-methylphenyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 81022530 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-tert-butyl-3-(5-fluoro-2-methylphenyl)-3-methylbutan-1-amine |
| SMILES | Cc1ccc(F)cc1C(C)(C)CCNC(C)(C)C |
| InChI | InChI=1S/C16H26FN/c1-12-7-8-13(17)11-14(12)16(5,6)9-10-18-15(2,3)4/h7-8,11,18H,9-10H2,1-6H3 |
| InChIKey | UZDKDZZKERFBDL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |