C18H30FN — CID 105374927
N-tert-butyl-2-[(5-fluoro-2-methylphenyl)methyl]-2-methylpentan-1-amine (PubChem CID 105374927) has the molecular formula C18H30FN and a molecular weight of 279.44 g/mol. Its IUPAC name is N-tert-butyl-2-[(5-fluoro-2-methylphenyl)methyl]-2-methylpentan-1-amine.
| Compound Name | N-tert-butyl-2-[(5-fluoro-2-methylphenyl)methyl]-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 105374927 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-tert-butyl-2-[(5-fluoro-2-methylphenyl)methyl]-2-methylpentan-1-amine |
| SMILES | CCCC(C)(CNC(C)(C)C)Cc1cc(F)ccc1C |
| InChI | InChI=1S/C18H30FN/c1-7-10-18(6,13-20-17(3,4)5)12-15-11-16(19)9-8-14(15)2/h8-9,11,20H,7,10,12-13H2,1-6H3 |
| InChIKey | KBBCVUYLWFUSAI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |