C14H18F4O2 — CID 107288624
2-ethoxy-1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-ol (PubChem CID 107288624) has the molecular formula C14H18F4O2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-ethoxy-1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-ol.
| Compound Name | 2-ethoxy-1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 107288624 |
| Molecular Formula | C14H18F4O2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-ethoxy-1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-ol |
| SMILES | CCOC(C(C)C)C(O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H18F4O2/c1-4-20-13(8(2)3)12(19)9-5-6-10(11(15)7-9)14(16,17)18/h5-8,12-13,19H,4H2,1-3H3 |
| InChIKey | MTPLTNZGAHVWQP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |