C15H20F4O2 — CID 107288640
2-ethoxy-2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 107288640) has the molecular formula C15H20F4O2 and a molecular weight of 308.32 g/mol. Its IUPAC name is 2-ethoxy-2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-ethoxy-2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 107288640 |
| Molecular Formula | C15H20F4O2 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-ethoxy-2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CCOC(CC)(CC)C(O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C15H20F4O2/c1-4-14(5-2,21-6-3)13(20)10-7-8-11(12(16)9-10)15(17,18)19/h7-9,13,20H,4-6H2,1-3H3 |
| InChIKey | FTCCMXGBBZKRMB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |