C13H16F4O2 — CID 107292089
1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-propoxypropan-1-ol (PubChem CID 107292089) has the molecular formula C13H16F4O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-propoxypropan-1-ol.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-propoxypropan-1-ol |
|---|---|
| PubChem CID | 107292089 |
| Molecular Formula | C13H16F4O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-propoxypropan-1-ol |
| SMILES | CCCOCCC(O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H16F4O2/c1-2-6-19-7-5-12(18)9-3-4-10(11(14)8-9)13(15,16)17/h3-4,8,12,18H,2,5-7H2,1H3 |
| InChIKey | OQULZKNKQDKGFW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|