C13H18F4N2O — CID 107292433
[1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxy-3-methylbutyl]hydrazine (PubChem CID 107292433) has the molecular formula C13H18F4N2O and a molecular weight of 294.29 g/mol. Its IUPAC name is [1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxy-3-methylbutyl]hydrazine.
| Compound Name | [1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxy-3-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 107292433 |
| Molecular Formula | C13H18F4N2O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxy-3-methylbutyl]hydrazine |
| SMILES | COC(C(C)C)C(NN)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H18F4N2O/c1-7(2)12(20-3)11(19-18)8-4-5-9(10(14)6-8)13(15,16)17/h4-7,11-12,19H,18H2,1-3H3 |
| InChIKey | HJXWPNKGAMXTGF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|