C15H21F4NO — CID 107289310
1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methoxy-N-propylbutan-1-amine (PubChem CID 107289310) has the molecular formula C15H21F4NO and a molecular weight of 307.33 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methoxy-N-propylbutan-1-amine.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methoxy-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 107289310 |
| Molecular Formula | C15H21F4NO |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methoxy-N-propylbutan-1-amine |
| SMILES | CCCNC(CC(C)OC)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C15H21F4NO/c1-4-7-20-14(8-10(2)21-3)11-5-6-12(13(16)9-11)15(17,18)19/h5-6,9-10,14,20H,4,7-8H2,1-3H3 |
| InChIKey | YGRPHPNCJVCQIN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |