C15H24FNO — CID 107129130
1-(3-fluoro-4-methylphenyl)-3-methoxy-N-propylbutan-1-amine (PubChem CID 107129130) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-methoxy-N-propylbutan-1-amine.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-methoxy-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 107129130 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-methoxy-N-propylbutan-1-amine |
| SMILES | CCCNC(CC(C)OC)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C15H24FNO/c1-5-8-17-15(9-12(3)18-4)13-7-6-11(2)14(16)10-13/h6-7,10,12,15,17H,5,8-9H2,1-4H3 |
| InChIKey | JYHITRBVVVXCBP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |