C15H16F3NO — CID 143924571
4-(cyclohepten-1-yl)-3-(trifluoromethyl)benzamide (PubChem CID 143924571) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is 4-(cyclohepten-1-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(cyclohepten-1-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143924571 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-(cyclohepten-1-yl)-3-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(C2=CCCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO/c16-15(17,18)13-9-11(14(19)20)7-8-12(13)10-5-3-1-2-4-6-10/h5,7-9H,1-4,6H2,(H2,19,20) |
| InChIKey | ROJSTZVCMUXSNH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |