C12H12F3NO4 — CID 115467582
2-[4-carbamoyl-2-(trifluoromethyl)phenoxy]butanoic acid (PubChem CID 115467582) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-[4-carbamoyl-2-(trifluoromethyl)phenoxy]butanoic acid.
| Compound Name | 2-[4-carbamoyl-2-(trifluoromethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 115467582 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[4-carbamoyl-2-(trifluoromethyl)phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(C(N)=O)cc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H12F3NO4/c1-2-8(11(18)19)20-9-4-3-6(10(16)17)5-7(9)12(13,14)15/h3-5,8H,2H2,1H3,(H2,16,17)(H,18,19) |
| InChIKey | SPANTFUGVVLTMQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |