C16H7F5O3 — CID 121271168
4-[2-(2,5-difluoro-4-hydroxyphenyl)ethynyl]-3-(trifluoromethyl)benzoic acid (PubChem CID 121271168) has the molecular formula C16H7F5O3 and a molecular weight of 342.22 g/mol. Its IUPAC name is 4-[2-(2,5-difluoro-4-hydroxyphenyl)ethynyl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[2-(2,5-difluoro-4-hydroxyphenyl)ethynyl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 121271168 |
| Molecular Formula | C16H7F5O3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-[2-(2,5-difluoro-4-hydroxyphenyl)ethynyl]-3-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C#Cc2cc(F)c(O)cc2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H7F5O3/c17-12-7-14(22)13(18)6-9(12)3-1-8-2-4-10(15(23)24)5-11(8)16(19,20)21/h2,4-7,22H,(H,23,24) |
| InChIKey | GPUNFLKJIARBOQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|