C17H11F3O3 — CID 145059507
4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-2-methylbenzoic acid (PubChem CID 145059507) has the molecular formula C17H11F3O3 and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-2-methylbenzoic acid.
| Compound Name | 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 145059507 |
| Molecular Formula | C17H11F3O3 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(C#Cc2ccc(O)cc2C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C17H11F3O3/c1-10-8-11(3-7-14(10)16(22)23)2-4-12-5-6-13(21)9-15(12)17(18,19)20/h3,5-9,21H,1H3,(H,22,23) |
| InChIKey | VBGQEQCYFKOLAZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|