C22H21F3O3 — CID 145059458
pentyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-methylbenzoate (PubChem CID 145059458) has the molecular formula C22H21F3O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is pentyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-methylbenzoate.
| Compound Name | pentyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 145059458 |
| Molecular Formula | C22H21F3O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | pentyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-methylbenzoate |
| SMILES | CCCCCOC(=O)c1ccc(C#Cc2ccc(O)cc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C22H21F3O3/c1-3-4-5-12-28-21(27)18-9-7-16(15(2)13-18)6-8-17-10-11-19(26)14-20(17)22(23,24)25/h7,9-11,13-14,26H,3-5,12H2,1-2H3 |
| InChIKey | ITESFIVAXNWCNV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|