C26H27F3O3 — CID 162575478
3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate (PubChem CID 162575478) has the molecular formula C26H27F3O3 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate.
| Compound Name | 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 162575478 |
| Molecular Formula | C26H27F3O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate |
| SMILES | C/C=C/c1cc(C(=O)OCCC(C)CCC)ccc1C#Cc1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3O3/c1-4-6-18(3)14-15-32-25(31)22-11-9-19(21(16-22)7-5-2)8-10-20-12-13-23(30)17-24(20)26(27,28)29/h5,7,9,11-13,16-18,30H,4,6,14-15H2,1-3H3/b7-5+ |
| InChIKey | HOSWHYNAGJFLRG-FNORWQNLSA-N |
| XLogP | 6.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|