About 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate
3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate (PubChem CID 162575478) has the molecular formula C26H27F3O3
and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate.
Molecular Properties
| Compound Name | 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate |
| PubChem CID | 162575478 |
| Molecular Formula | C26H27F3O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate |
| SMILES | C/C=C/c1cc(C(=O)OCCC(C)CCC)ccc1C#Cc1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3O3/c1-4-6-18(3)14-15-32-25(31)22-11-9-19(21(16-22)7-5-2)8-10-20-12-13-23(30)17-24(20)26(27,28)29/h5,7,9,11-13,16-18,30H,4,6,14-15H2,1-3H3/b7-5+ |
| InChIKey | HOSWHYNAGJFLRG-FNORWQNLSA-N |
| XLogP | 6.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate?
The IUPAC name of 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate (CID 162575478) is 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate.
What is the SMILES notation for 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate?
The canonical SMILES for 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate is C/C=C/c1cc(C(=O)OCCC(C)CCC)ccc1C#Cc1ccc(O)cc1C(F)(F)F.
What is the InChIKey of 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate?
The InChIKey is HOSWHYNAGJFLRG-FNORWQNLSA-N. The full InChI is InChI=1S/C26H27F3O3/c1-4-6-18(3)14-15-32-25(31)22-11-9-19(21(16-22)7-5-2)8-10-20-12-13-23(30)17-24(20)26(27,28)29/h5,7,9,11-13,16-18,30H,4,6,14-15H2,1-3H3/b7-5+.
What are the key properties of 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate?
3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate has a molecular weight of 444.49 g/mol, XLogP of 6.83, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexyl 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[(E)-prop-1-enyl]benzoate is sourced from PubChem (CID 162575478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).