C25H14F5NO3 — CID 145059321
ethyl 3-(4-cyano-3,5-difluorophenyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate (PubChem CID 145059321) has the molecular formula C25H14F5NO3 and a molecular weight of 471.38 g/mol. Its IUPAC name is ethyl 3-(4-cyano-3,5-difluorophenyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate.
| Compound Name | ethyl 3-(4-cyano-3,5-difluorophenyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 145059321 |
| Molecular Formula | C25H14F5NO3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | ethyl 3-(4-cyano-3,5-difluorophenyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc(O)cc2C(F)(F)F)c(-c2cc(F)c(C#N)c(F)c2)c1 |
| InChI | InChI=1S/C25H14F5NO3/c1-2-34-24(33)16-6-4-14(3-5-15-7-8-18(32)12-21(15)25(28,29)30)19(9-16)17-10-22(26)20(13-31)23(27)11-17/h4,6-12,32H,2H2,1H3 |
| InChIKey | CHUXETCVYLOAFO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|