C22H20F4O3 — CID 121271418
hexyl 3-fluoro-2-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate (PubChem CID 121271418) has the molecular formula C22H20F4O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is hexyl 3-fluoro-2-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate.
| Compound Name | hexyl 3-fluoro-2-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 121271418 |
| Molecular Formula | C22H20F4O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | hexyl 3-fluoro-2-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoate |
| SMILES | CCCCCCOC(=O)c1cccc(F)c1C#Cc1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C22H20F4O3/c1-2-3-4-5-13-29-21(28)18-7-6-8-20(23)17(18)12-10-15-9-11-16(27)14-19(15)22(24,25)26/h6-9,11,14,27H,2-5,13H2,1H3 |
| InChIKey | NFACSTDSPDVNLD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|