About 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate
4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate (PubChem CID 91726947) has the molecular formula C20H26F4O4
and a molecular weight of 406.42 g/mol. Its IUPAC name is 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate |
| PubChem CID | 91726947 |
| Molecular Formula | C20H26F4O4 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate |
| SMILES | CCCCCCCCOC(=O)CCC(=O)OCc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C20H26F4O4/c1-2-3-4-5-6-7-13-27-18(25)11-12-19(26)28-14-15-16(20(22,23)24)9-8-10-17(15)21/h8-10H,2-7,11-14H2,1H3 |
| InChIKey | UTXRYTHMBWTBOZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate?
The IUPAC name of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate (CID 91726947) is 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate.
What is the SMILES notation for 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate?
The canonical SMILES for 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate is CCCCCCCCOC(=O)CCC(=O)OCc1c(F)cccc1C(F)(F)F.
What is the InChIKey of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate?
The InChIKey is UTXRYTHMBWTBOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F4O4/c1-2-3-4-5-6-7-13-27-18(25)11-12-19(26)28-14-15-16(20(22,23)24)9-8-10-17(15)21/h8-10H,2-7,11-14H2,1H3.
What are the key properties of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate?
4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate has a molecular weight of 406.42 g/mol, XLogP of 5.57, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-octyl butanedioate is sourced from PubChem (CID 91726947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).