C15H16F4O4 — CID 91726949
4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl butanedioate (PubChem CID 91726949) has the molecular formula C15H16F4O4 and a molecular weight of 336.28 g/mol. Its IUPAC name is 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl butanedioate.
| Compound Name | 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl butanedioate |
|---|---|
| PubChem CID | 91726949 |
| Molecular Formula | C15H16F4O4 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl butanedioate |
| SMILES | CCCOC(=O)CCC(=O)OCc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C15H16F4O4/c1-2-8-22-13(20)6-7-14(21)23-9-10-11(15(17,18)19)4-3-5-12(10)16/h3-5H,2,6-9H2,1H3 |
| InChIKey | OFSRBTSSMHJSIT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |