C14H14F4O2 — CID 22387504
7-[2-fluoro-6-(trifluoromethyl)phenyl]heptane-2,5-dione (PubChem CID 22387504) has the molecular formula C14H14F4O2 and a molecular weight of 290.26 g/mol. Its IUPAC name is 7-[2-fluoro-6-(trifluoromethyl)phenyl]heptane-2,5-dione.
| Compound Name | 7-[2-fluoro-6-(trifluoromethyl)phenyl]heptane-2,5-dione |
|---|---|
| PubChem CID | 22387504 |
| Molecular Formula | C14H14F4O2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 7-[2-fluoro-6-(trifluoromethyl)phenyl]heptane-2,5-dione |
| SMILES | CC(=O)CCC(=O)CCc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H14F4O2/c1-9(19)5-6-10(20)7-8-11-12(14(16,17)18)3-2-4-13(11)15/h2-4H,5-8H2,1H3 |
| InChIKey | SBRRWNBWRKAAFC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |