C17H12F6O — CID 175279954
1,5-bis(2,3,6-trifluorophenyl)pentan-3-one (PubChem CID 175279954) has the molecular formula C17H12F6O and a molecular weight of 346.27 g/mol. Its IUPAC name is 1,5-bis(2,3,6-trifluorophenyl)pentan-3-one.
| Compound Name | 1,5-bis(2,3,6-trifluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 175279954 |
| Molecular Formula | C17H12F6O |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1,5-bis(2,3,6-trifluorophenyl)pentan-3-one |
| SMILES | O=C(CCc1c(F)ccc(F)c1F)CCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C17H12F6O/c18-12-5-7-14(20)16(22)10(12)3-1-9(24)2-4-11-13(19)6-8-15(21)17(11)23/h5-8H,1-4H2 |
| InChIKey | YMIOXCHMZQBUFC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|