C10H6F3NO — CID 88950111
1-isocyano-3-(2,3,6-trifluorophenyl)propan-2-one (PubChem CID 88950111) has the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. Its IUPAC name is 1-isocyano-3-(2,3,6-trifluorophenyl)propan-2-one.
| Compound Name | 1-isocyano-3-(2,3,6-trifluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 88950111 |
| Molecular Formula | C10H6F3NO |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 1-isocyano-3-(2,3,6-trifluorophenyl)propan-2-one |
| SMILES | [C-]#[N+]CC(=O)Cc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C10H6F3NO/c1-14-5-6(15)4-7-8(11)2-3-9(12)10(7)13/h2-3H,4-5H2 |
| InChIKey | JRPIJXMSKUUGOJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|