C14H18F4O — CID 130204928
1-fluoro-2-(hexan-3-yloxymethyl)-3-(trifluoromethyl)benzene (PubChem CID 130204928) has the molecular formula C14H18F4O and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-fluoro-2-(hexan-3-yloxymethyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-fluoro-2-(hexan-3-yloxymethyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 130204928 |
| Molecular Formula | C14H18F4O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-fluoro-2-(hexan-3-yloxymethyl)-3-(trifluoromethyl)benzene |
| SMILES | CCCC(CC)OCc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H18F4O/c1-3-6-10(4-2)19-9-11-12(14(16,17)18)7-5-8-13(11)15/h5,7-8,10H,3-4,6,9H2,1-2H3 |
| InChIKey | MAQFYTJDXGGBOG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |