C22H18F3NO2 — CID 145059605
4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-(4-methyl-3-oxopentyl)benzonitrile (PubChem CID 145059605) has the molecular formula C22H18F3NO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-(4-methyl-3-oxopentyl)benzonitrile.
| Compound Name | 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-(4-methyl-3-oxopentyl)benzonitrile |
|---|---|
| PubChem CID | 145059605 |
| Molecular Formula | C22H18F3NO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-(4-methyl-3-oxopentyl)benzonitrile |
| SMILES | CC(C)C(=O)CCc1cc(C#N)ccc1C#Cc1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C22H18F3NO2/c1-14(2)21(28)10-8-18-11-15(13-26)3-4-16(18)5-6-17-7-9-19(27)12-20(17)22(23,24)25/h3-4,7,9,11-12,14,27H,8,10H2,1-2H3 |
| InChIKey | PVANDFWDGDPEKX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|