C23H18F3N3O — CID 121271231
4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[3-(2-methylimidazol-1-yl)propyl]benzonitrile (PubChem CID 121271231) has the molecular formula C23H18F3N3O and a molecular weight of 409.41 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[3-(2-methylimidazol-1-yl)propyl]benzonitrile.
| Compound Name | 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[3-(2-methylimidazol-1-yl)propyl]benzonitrile |
|---|---|
| PubChem CID | 121271231 |
| Molecular Formula | C23H18F3N3O |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]-3-[3-(2-methylimidazol-1-yl)propyl]benzonitrile |
| SMILES | Cc1nccn1CCCc1cc(C#N)ccc1C#Cc1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C23H18F3N3O/c1-16-28-10-12-29(16)11-2-3-20-13-17(15-27)4-5-18(20)6-7-19-8-9-21(30)14-22(19)23(24,25)26/h4-5,8-10,12-14,30H,2-3,11H2,1H3 |
| InChIKey | YZASBZAKIXFGJB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|