C14H15N3O — CID 43289188
3-[3-(2-methylimidazol-1-yl)propoxy]benzonitrile (PubChem CID 43289188) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[3-(2-methylimidazol-1-yl)propoxy]benzonitrile.
| Compound Name | 3-[3-(2-methylimidazol-1-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 43289188 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-[3-(2-methylimidazol-1-yl)propoxy]benzonitrile |
| SMILES | Cc1nccn1CCCOc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H15N3O/c1-12-16-6-8-17(12)7-3-9-18-14-5-2-4-13(10-14)11-15/h2,4-6,8,10H,3,7,9H2,1H3 |
| InChIKey | PMVVOVOCZSZFPJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|