C19H14F4O3 — CID 121271407
3-(3-fluoropropyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoic acid (PubChem CID 121271407) has the molecular formula C19H14F4O3 and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-(3-fluoropropyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoic acid.
| Compound Name | 3-(3-fluoropropyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 121271407 |
| Molecular Formula | C19H14F4O3 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(3-fluoropropyl)-4-[2-[4-hydroxy-2-(trifluoromethyl)phenyl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C#Cc2ccc(O)cc2C(F)(F)F)c(CCCF)c1 |
| InChI | InChI=1S/C19H14F4O3/c20-9-1-2-14-10-15(18(25)26)6-4-12(14)3-5-13-7-8-16(24)11-17(13)19(21,22)23/h4,6-8,10-11,24H,1-2,9H2,(H,25,26) |
| InChIKey | XZJSCSQAWRNQBA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|